C11H19NO — CID 141266412
1-(1-azatricyclo[3.3.1.13,7]decan-4-yl)ethanol (PubChem CID 141266412) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-(1-azatricyclo[3.3.1.13,7]decan-4-yl)ethanol.
| Compound Name | 1-(1-azatricyclo[3.3.1.13,7]decan-4-yl)ethanol |
|---|---|
| PubChem CID | 141266412 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 1-(1-azatricyclo[3.3.1.13,7]decan-4-yl)ethanol |
| SMILES | CC(O)C1C2CC3CC1CN(C3)C2 |
| InChI | InChI=1S/C11H19NO/c1-7(13)11-9-2-8-3-10(11)6-12(4-8)5-9/h7-11,13H,2-6H2,1H3 |
| InChIKey | FPFJRYVSNYRADV-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |