About 1-(1-azatricyclo[3.3.1.13,7]decan-4-yl)ethanol
1-(1-azatricyclo[3.3.1.13,7]decan-4-yl)ethanol (PubChem CID 141266412) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-(1-azatricyclo[3.3.1.13,7]decan-4-yl)ethanol.
Molecular Properties
| Compound Name | 1-(1-azatricyclo[3.3.1.13,7]decan-4-yl)ethanol |
| PubChem CID | 141266412 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 1-(1-azatricyclo[3.3.1.13,7]decan-4-yl)ethanol |
| SMILES | CC(O)C1C2CC3CC1CN(C3)C2 |
| InChI | InChI=1S/C11H19NO/c1-7(13)11-9-2-8-3-10(11)6-12(4-8)5-9/h7-11,13H,2-6H2,1H3 |
| InChIKey | FPFJRYVSNYRADV-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-azatricyclo[3.3.1.13,7]decan-4-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-azatricyclo[3.3.1.13,7]decan-4-yl)ethanol?
The IUPAC name of 1-(1-azatricyclo[3.3.1.13,7]decan-4-yl)ethanol (CID 141266412) is 1-(1-azatricyclo[3.3.1.13,7]decan-4-yl)ethanol.
What is the SMILES notation for 1-(1-azatricyclo[3.3.1.13,7]decan-4-yl)ethanol?
The canonical SMILES for 1-(1-azatricyclo[3.3.1.13,7]decan-4-yl)ethanol is CC(O)C1C2CC3CC1CN(C3)C2.
What is the InChIKey of 1-(1-azatricyclo[3.3.1.13,7]decan-4-yl)ethanol?
The InChIKey is FPFJRYVSNYRADV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO/c1-7(13)11-9-2-8-3-10(11)6-12(4-8)5-9/h7-11,13H,2-6H2,1H3.
What are the key properties of 1-(1-azatricyclo[3.3.1.13,7]decan-4-yl)ethanol?
1-(1-azatricyclo[3.3.1.13,7]decan-4-yl)ethanol has a molecular weight of 181.28 g/mol, XLogP of 0.95, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-azatricyclo[3.3.1.13,7]decan-4-yl)ethanol is sourced from PubChem (CID 141266412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).