C13H19BrO4 — CID 141267189
2-(2-bromo-3,4-dimethoxyphenyl)pentane-1,3-diol (PubChem CID 141267189) has the molecular formula C13H19BrO4 and a molecular weight of 319.20 g/mol. Its IUPAC name is 2-(2-bromo-3,4-dimethoxyphenyl)pentane-1,3-diol.
| Compound Name | 2-(2-bromo-3,4-dimethoxyphenyl)pentane-1,3-diol |
|---|---|
| PubChem CID | 141267189 |
| Molecular Formula | C13H19BrO4 |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 2-(2-bromo-3,4-dimethoxyphenyl)pentane-1,3-diol |
| SMILES | CCC(O)C(CO)c1ccc(OC)c(OC)c1Br |
| InChI | InChI=1S/C13H19BrO4/c1-4-10(16)9(7-15)8-5-6-11(17-2)13(18-3)12(8)14/h5-6,9-10,15-16H,4,7H2,1-3H3 |
| InChIKey | UAXTXKYFDHENLX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |