About ethyl 3-[2-ethyl-4-[(Z)-N'-hydroxycarbamimidoyl]-6-methylphenyl]prop-2-enoate
ethyl 3-[2-ethyl-4-[(Z)-N'-hydroxycarbamimidoyl]-6-methylphenyl]prop-2-enoate (PubChem CID 141267766) has the molecular formula C15H20N2O3
and a molecular weight of 276.34 g/mol. Its IUPAC name is ethyl 3-[2-ethyl-4-[(Z)-N'-hydroxycarbamimidoyl]-6-methylphenyl]prop-2-enoate.
Molecular Properties
| Compound Name | ethyl 3-[2-ethyl-4-[(Z)-N'-hydroxycarbamimidoyl]-6-methylphenyl]prop-2-enoate |
| PubChem CID | 141267766 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | ethyl 3-[2-ethyl-4-[(Z)-N'-hydroxycarbamimidoyl]-6-methylphenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1c(C)cc(/C(N)=N/O)cc1CC |
| InChI | InChI=1S/C15H20N2O3/c1-4-11-9-12(15(16)17-19)8-10(3)13(11)6-7-14(18)20-5-2/h6-9,19H,4-5H2,1-3H3,(H2,16,17) |
| InChIKey | BIOPQESBBCEFNN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[2-ethyl-4-[(Z)-N'-hydroxycarbamimidoyl]-6-methylphenyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[2-ethyl-4-[(Z)-N'-hydroxycarbamimidoyl]-6-methylphenyl]prop-2-enoate?
The IUPAC name of ethyl 3-[2-ethyl-4-[(Z)-N'-hydroxycarbamimidoyl]-6-methylphenyl]prop-2-enoate (CID 141267766) is ethyl 3-[2-ethyl-4-[(Z)-N'-hydroxycarbamimidoyl]-6-methylphenyl]prop-2-enoate.
What is the SMILES notation for ethyl 3-[2-ethyl-4-[(Z)-N'-hydroxycarbamimidoyl]-6-methylphenyl]prop-2-enoate?
The canonical SMILES for ethyl 3-[2-ethyl-4-[(Z)-N'-hydroxycarbamimidoyl]-6-methylphenyl]prop-2-enoate is CCOC(=O)C=Cc1c(C)cc(/C(N)=N/O)cc1CC.
What is the InChIKey of ethyl 3-[2-ethyl-4-[(Z)-N'-hydroxycarbamimidoyl]-6-methylphenyl]prop-2-enoate?
The InChIKey is BIOPQESBBCEFNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O3/c1-4-11-9-12(15(16)17-19)8-10(3)13(11)6-7-14(18)20-5-2/h6-9,19H,4-5H2,1-3H3,(H2,16,17).
What are the key properties of ethyl 3-[2-ethyl-4-[(Z)-N'-hydroxycarbamimidoyl]-6-methylphenyl]prop-2-enoate?
ethyl 3-[2-ethyl-4-[(Z)-N'-hydroxycarbamimidoyl]-6-methylphenyl]prop-2-enoate has a molecular weight of 276.34 g/mol, XLogP of 2.23, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[2-ethyl-4-[(Z)-N'-hydroxycarbamimidoyl]-6-methylphenyl]prop-2-enoate is sourced from PubChem (CID 141267766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).