C20H25N3O3 — CID 91380660
[2-ethyl-4-(N'-hydroxycarbamimidoyl)-6-methylphenyl] 5,6-diethylpyridine-3-carboxylate (PubChem CID 91380660) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is [2-ethyl-4-(N'-hydroxycarbamimidoyl)-6-methylphenyl] 5,6-diethylpyridine-3-carboxylate.
| Compound Name | [2-ethyl-4-(N'-hydroxycarbamimidoyl)-6-methylphenyl] 5,6-diethylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 91380660 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | [2-ethyl-4-(N'-hydroxycarbamimidoyl)-6-methylphenyl] 5,6-diethylpyridine-3-carboxylate |
| SMILES | CCc1cc(C(=O)Oc2c(C)cc(C(N)=NO)cc2CC)cnc1CC |
| InChI | InChI=1S/C20H25N3O3/c1-5-13-9-16(11-22-17(13)7-3)20(24)26-18-12(4)8-15(19(21)23-25)10-14(18)6-2/h8-11,25H,5-7H2,1-4H3,(H2,21,23) |
| InChIKey | GSVQHUJJTLTKSX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|