C21H30N6O6 — CID 141271750
2-amino-3-(1H-indol-3-yl)propanoic acid;2,6-diaminohexanoic acid;1H-pyrimidine-2,4-dione (PubChem CID 141271750) has the molecular formula C21H30N6O6 and a molecular weight of 462.51 g/mol. Its IUPAC name is 2-amino-3-(1H-indol-3-yl)propanoic acid;2,6-diaminohexanoic acid;1H-pyrimidine-2,4-dione.
| Compound Name | 2-amino-3-(1H-indol-3-yl)propanoic acid;2,6-diaminohexanoic acid;1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 141271750 |
| Molecular Formula | C21H30N6O6 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 2-amino-3-(1H-indol-3-yl)propanoic acid;2,6-diaminohexanoic acid;1H-pyrimidine-2,4-dione |
| SMILES | NC(Cc1c[nH]c2ccccc12)C(=O)O.NCCCCC(N)C(=O)O.O=c1cc[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C11H12N2O2.C6H14N2O2.C4H4N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10;7-4-2-1-3-5(8)6(9)10;7-3-1-2-5-4(8)6-3/h1-4,6,9,13H,5,12H2,(H,14,15);5H,1-4,7-8H2,(H,9,10);1-2H,(H2,5,6,7,8) |
| InChIKey | BMONYNPGLPDYJE-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 234.17 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|