C27H56OSiSn — CID 14127261
tert-butyl-[(E,1S)-1-cyclohexyl-3-tributylstannylprop-2-enoxy]-dimethylsilane (PubChem CID 14127261) has the molecular formula C27H56OSiSn and a molecular weight of 543.54 g/mol. Its IUPAC name is tert-butyl-[(E,1S)-1-cyclohexyl-3-tributylstannylprop-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E,1S)-1-cyclohexyl-3-tributylstannylprop-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 14127261 |
| Molecular Formula | C27H56OSiSn |
| Molecular Weight | 543.54 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | tert-butyl-[(E,1S)-1-cyclohexyl-3-tributylstannylprop-2-enoxy]-dimethylsilane |
| SMILES | CCCC[Sn](/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)C1CCCCC1)(CCCC)CCCC |
| InChI | InChI=1S/C15H29OSi.3C4H9.Sn/c1-7-14(13-11-9-8-10-12-13)16-17(5,6)15(2,3)4;3*1-3-4-2;/h1,7,13-14H,8-12H2,2-6H3;3*1,3-4H2,2H3;/t14-;;;;/m1..../s1 |
| InChIKey | FVWKLDBQHUFBOB-WGVOJFRMSA-N |
| XLogP | 9.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.54 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|