C9H17N5 — CID 141273664
5-ethenyl-N-ethyl-6-ethylimino-1,4-dihydro-1,3,5-triazin-2-amine (PubChem CID 141273664) has the molecular formula C9H17N5 and a molecular weight of 195.27 g/mol. Its IUPAC name is 5-ethenyl-N-ethyl-6-ethylimino-1,4-dihydro-1,3,5-triazin-2-amine.
| Compound Name | 5-ethenyl-N-ethyl-6-ethylimino-1,4-dihydro-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 141273664 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 5-ethenyl-N-ethyl-6-ethylimino-1,4-dihydro-1,3,5-triazin-2-amine |
| SMILES | C=CN1CN=C(NCC)N/C1=N/CC |
| InChI | InChI=1S/C9H17N5/c1-4-10-8-12-7-14(6-3)9(13-8)11-5-2/h6H,3-5,7H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | QNLJLKKEGQBBBW-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|