C20H16FNO6 — CID 141275277
(2R)-3-(4-fluorobenzoyl)-2-(4-methoxyphenyl)-1,2-dihydropyrrole-5,5-dicarboxylic acid (PubChem CID 141275277) has the molecular formula C20H16FNO6 and a molecular weight of 385.35 g/mol. Its IUPAC name is (2R)-3-(4-fluorobenzoyl)-2-(4-methoxyphenyl)-1,2-dihydropyrrole-5,5-dicarboxylic acid.
| Compound Name | (2R)-3-(4-fluorobenzoyl)-2-(4-methoxyphenyl)-1,2-dihydropyrrole-5,5-dicarboxylic acid |
|---|---|
| PubChem CID | 141275277 |
| Molecular Formula | C20H16FNO6 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | (2R)-3-(4-fluorobenzoyl)-2-(4-methoxyphenyl)-1,2-dihydropyrrole-5,5-dicarboxylic acid |
| SMILES | COc1ccc([C@H]2NC(C(=O)O)(C(=O)O)C=C2C(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H16FNO6/c1-28-14-8-4-11(5-9-14)16-15(10-20(22-16,18(24)25)19(26)27)17(23)12-2-6-13(21)7-3-12/h2-10,16,22H,1H3,(H,24,25)(H,26,27)/t16-/m1/s1 |
| InChIKey | QLLWRQDQOIPJNA-MRXNPFEDSA-N |
| XLogP | 2.20 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|