About 2-amino-4-(1,3-thiazol-4-yl)thiophene-3-carbonitrile
2-amino-4-(1,3-thiazol-4-yl)thiophene-3-carbonitrile (PubChem CID 141275983) has the molecular formula C8H5N3S2
and a molecular weight of 207.28 g/mol. Its IUPAC name is 2-amino-4-(1,3-thiazol-4-yl)thiophene-3-carbonitrile.
Analyze 2-amino-4-(1,3-thiazol-4-yl)thiophene-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(1,3-thiazol-4-yl)thiophene-3-carbonitrile?
The IUPAC name of 2-amino-4-(1,3-thiazol-4-yl)thiophene-3-carbonitrile (CID 141275983) is 2-amino-4-(1,3-thiazol-4-yl)thiophene-3-carbonitrile.
What is the SMILES notation for 2-amino-4-(1,3-thiazol-4-yl)thiophene-3-carbonitrile?
The canonical SMILES for 2-amino-4-(1,3-thiazol-4-yl)thiophene-3-carbonitrile is N#Cc1c(-c2cscn2)csc1N.
What is the InChIKey of 2-amino-4-(1,3-thiazol-4-yl)thiophene-3-carbonitrile?
The InChIKey is VTDZQSWGUXXRFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3S2/c9-1-5-6(2-13-8(5)10)7-3-12-4-11-7/h2-4H,10H2.
What are the key properties of 2-amino-4-(1,3-thiazol-4-yl)thiophene-3-carbonitrile?
2-amino-4-(1,3-thiazol-4-yl)thiophene-3-carbonitrile has a molecular weight of 207.28 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(1,3-thiazol-4-yl)thiophene-3-carbonitrile is sourced from PubChem (CID 141275983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).