C28H24O4 — CID 141276172
benzene;4-ethenyl-3-[3-(6-ethenyl-2,3-dihydroxyphenyl)phenyl]benzene-1,2-diol (PubChem CID 141276172) has the molecular formula C28H24O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is benzene;4-ethenyl-3-[3-(6-ethenyl-2,3-dihydroxyphenyl)phenyl]benzene-1,2-diol.
| Compound Name | benzene;4-ethenyl-3-[3-(6-ethenyl-2,3-dihydroxyphenyl)phenyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 141276172 |
| Molecular Formula | C28H24O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | benzene;4-ethenyl-3-[3-(6-ethenyl-2,3-dihydroxyphenyl)phenyl]benzene-1,2-diol |
| SMILES | C=Cc1ccc(O)c(O)c1-c1cccc(-c2c(C=C)ccc(O)c2O)c1.c1ccccc1 |
| InChI | InChI=1S/C22H18O4.C6H6/c1-3-13-8-10-17(23)21(25)19(13)15-6-5-7-16(12-15)20-14(4-2)9-11-18(24)22(20)26;1-2-4-6-5-3-1/h3-12,23-26H,1-2H2;1-6H |
| InChIKey | VPWDXCDSERWYEQ-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|