C15H11N3OS — CID 141277956
2,4-dipyridin-4-ylthiophene-3-carboxamide (PubChem CID 141277956) has the molecular formula C15H11N3OS and a molecular weight of 281.34 g/mol. Its IUPAC name is 2,4-dipyridin-4-ylthiophene-3-carboxamide.
| Compound Name | 2,4-dipyridin-4-ylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 141277956 |
| Molecular Formula | C15H11N3OS |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 2,4-dipyridin-4-ylthiophene-3-carboxamide |
| SMILES | NC(=O)c1c(-c2ccncc2)csc1-c1ccncc1 |
| InChI | InChI=1S/C15H11N3OS/c16-15(19)13-12(10-1-5-17-6-2-10)9-20-14(13)11-3-7-18-8-4-11/h1-9H,(H2,16,19) |
| InChIKey | HDSMRJVJXCDZRA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |