C8H12BrN — CID 141279725
4-bromo-1,5,6-trimethyl-2H-pyridine (PubChem CID 141279725) has the molecular formula C8H12BrN and a molecular weight of 202.09 g/mol. Its IUPAC name is 4-bromo-1,5,6-trimethyl-2H-pyridine.
| Compound Name | 4-bromo-1,5,6-trimethyl-2H-pyridine |
|---|---|
| PubChem CID | 141279725 |
| Molecular Formula | C8H12BrN |
| Molecular Weight | 202.09 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | 4-bromo-1,5,6-trimethyl-2H-pyridine |
| SMILES | CC1=C(C)N(C)CC=C1Br |
| InChI | InChI=1S/C8H12BrN/c1-6-7(2)10(3)5-4-8(6)9/h4H,5H2,1-3H3 |
| InChIKey | IRSHQOFCNVPCRP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.09 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |