C30H23NO9 — CID 141280953
4-[2-(4-nitrophenoxy)-4,6-bis(phenylmethoxy)phenyl]-2,4-dioxobutanoic acid (PubChem CID 141280953) has the molecular formula C30H23NO9 and a molecular weight of 541.51 g/mol. Its IUPAC name is 4-[2-(4-nitrophenoxy)-4,6-bis(phenylmethoxy)phenyl]-2,4-dioxobutanoic acid.
| Compound Name | 4-[2-(4-nitrophenoxy)-4,6-bis(phenylmethoxy)phenyl]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 141280953 |
| Molecular Formula | C30H23NO9 |
| Molecular Weight | 541.51 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | 4-[2-(4-nitrophenoxy)-4,6-bis(phenylmethoxy)phenyl]-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)c1c(OCc2ccccc2)cc(OCc2ccccc2)cc1Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H23NO9/c32-25(17-26(33)30(34)35)29-27(39-19-21-9-5-2-6-10-21)15-24(38-18-20-7-3-1-4-8-20)16-28(29)40-23-13-11-22(12-14-23)31(36)37/h1-16H,17-19H2,(H,34,35) |
| InChIKey | AXIRGCCCONOOEC-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 142.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.51 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|