C32H26N2O8 — CID 66759309
ethyl 5-[2-(4-nitrophenoxy)-4,6-bis(phenylmethoxy)phenyl]-1,2-oxazole-3-carboxylate (PubChem CID 66759309) has the molecular formula C32H26N2O8 and a molecular weight of 566.57 g/mol. Its IUPAC name is ethyl 5-[2-(4-nitrophenoxy)-4,6-bis(phenylmethoxy)phenyl]-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-[2-(4-nitrophenoxy)-4,6-bis(phenylmethoxy)phenyl]-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 66759309 |
| Molecular Formula | C32H26N2O8 |
| Molecular Weight | 566.57 g/mol |
| Exact Mass | 566.17 |
| IUPAC Name | ethyl 5-[2-(4-nitrophenoxy)-4,6-bis(phenylmethoxy)phenyl]-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2c(OCc3ccccc3)cc(OCc3ccccc3)cc2Oc2ccc([N+](=O)[O-])cc2)on1 |
| InChI | InChI=1S/C32H26N2O8/c1-2-38-32(35)27-19-30(42-33-27)31-28(40-21-23-11-7-4-8-12-23)17-26(39-20-22-9-5-3-6-10-22)18-29(31)41-25-15-13-24(14-16-25)34(36)37/h3-19H,2,20-21H2,1H3 |
| InChIKey | TZURISJVRANJJQ-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 123.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.57 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|