C32H27N3O7 — CID 66759174
N-ethyl-5-[2-(4-nitrophenoxy)-4,6-bis(phenylmethoxy)phenyl]-1,2-oxazole-3-carboxamide (PubChem CID 66759174) has the molecular formula C32H27N3O7 and a molecular weight of 565.58 g/mol. Its IUPAC name is N-ethyl-5-[2-(4-nitrophenoxy)-4,6-bis(phenylmethoxy)phenyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-ethyl-5-[2-(4-nitrophenoxy)-4,6-bis(phenylmethoxy)phenyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 66759174 |
| Molecular Formula | C32H27N3O7 |
| Molecular Weight | 565.58 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | N-ethyl-5-[2-(4-nitrophenoxy)-4,6-bis(phenylmethoxy)phenyl]-1,2-oxazole-3-carboxamide |
| SMILES | CCNC(=O)c1cc(-c2c(OCc3ccccc3)cc(OCc3ccccc3)cc2Oc2ccc([N+](=O)[O-])cc2)on1 |
| InChI | InChI=1S/C32H27N3O7/c1-2-33-32(36)27-19-30(42-34-27)31-28(40-21-23-11-7-4-8-12-23)17-26(39-20-22-9-5-3-6-10-22)18-29(31)41-25-15-13-24(14-16-25)35(37)38/h3-19H,2,20-21H2,1H3,(H,33,36) |
| InChIKey | XMEUEKIHLROPHZ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 125.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.58 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|