C32H27NO9 — CID 66758581
ethyl 4-[2-(4-nitrophenoxy)-4,6-bis(phenylmethoxy)phenyl]-2,4-dioxobutanoate (PubChem CID 66758581) has the molecular formula C32H27NO9 and a molecular weight of 569.57 g/mol. Its IUPAC name is ethyl 4-[2-(4-nitrophenoxy)-4,6-bis(phenylmethoxy)phenyl]-2,4-dioxobutanoate.
| Compound Name | ethyl 4-[2-(4-nitrophenoxy)-4,6-bis(phenylmethoxy)phenyl]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 66758581 |
| Molecular Formula | C32H27NO9 |
| Molecular Weight | 569.57 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | ethyl 4-[2-(4-nitrophenoxy)-4,6-bis(phenylmethoxy)phenyl]-2,4-dioxobutanoate |
| SMILES | CCOC(=O)C(=O)CC(=O)c1c(OCc2ccccc2)cc(OCc2ccccc2)cc1Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H27NO9/c1-2-39-32(36)28(35)19-27(34)31-29(41-21-23-11-7-4-8-12-23)17-26(40-20-22-9-5-3-6-10-22)18-30(31)42-25-15-13-24(14-16-25)33(37)38/h3-18H,2,19-21H2,1H3 |
| InChIKey | IZKARSGYEOJTFT-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 131.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.57 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|