C18H10F3N3OS — CID 141284717
4-[5-(3,4-difluorophenyl)thieno[2,3-d]pyrimidin-4-yl]oxy-3-fluoroaniline (PubChem CID 141284717) has the molecular formula C18H10F3N3OS and a molecular weight of 373.36 g/mol. Its IUPAC name is 4-[5-(3,4-difluorophenyl)thieno[2,3-d]pyrimidin-4-yl]oxy-3-fluoroaniline.
| Compound Name | 4-[5-(3,4-difluorophenyl)thieno[2,3-d]pyrimidin-4-yl]oxy-3-fluoroaniline |
|---|---|
| PubChem CID | 141284717 |
| Molecular Formula | C18H10F3N3OS |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 4-[5-(3,4-difluorophenyl)thieno[2,3-d]pyrimidin-4-yl]oxy-3-fluoroaniline |
| SMILES | Nc1ccc(Oc2ncnc3scc(-c4ccc(F)c(F)c4)c23)c(F)c1 |
| InChI | InChI=1S/C18H10F3N3OS/c19-12-3-1-9(5-13(12)20)11-7-26-18-16(11)17(23-8-24-18)25-15-4-2-10(22)6-14(15)21/h1-8H,22H2 |
| InChIKey | ZGCRURFZMJQXJZ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|