C28H14N4O7 — CID 141291458
2-(5-carboxy-1,10-phenanthroline-2-carbonyl)oxycarbonyl-1,10-phenanthroline-5-carboxylic acid (PubChem CID 141291458) has the molecular formula C28H14N4O7 and a molecular weight of 518.44 g/mol. Its IUPAC name is 2-(5-carboxy-1,10-phenanthroline-2-carbonyl)oxycarbonyl-1,10-phenanthroline-5-carboxylic acid.
| Compound Name | 2-(5-carboxy-1,10-phenanthroline-2-carbonyl)oxycarbonyl-1,10-phenanthroline-5-carboxylic acid |
|---|---|
| PubChem CID | 141291458 |
| Molecular Formula | C28H14N4O7 |
| Molecular Weight | 518.44 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | 2-(5-carboxy-1,10-phenanthroline-2-carbonyl)oxycarbonyl-1,10-phenanthroline-5-carboxylic acid |
| SMILES | O=C(OC(=O)c1ccc2c(C(=O)O)cc3cccnc3c2n1)c1ccc2c(C(=O)O)cc3cccnc3c2n1 |
| InChI | InChI=1S/C28H14N4O7/c33-25(34)17-11-13-3-1-9-29-21(13)23-15(17)5-7-19(31-23)27(37)39-28(38)20-8-6-16-18(26(35)36)12-14-4-2-10-30-22(14)24(16)32-20/h1-12H,(H,33,34)(H,35,36) |
| InChIKey | YJSPAQVNNWDURR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 169.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|