C24H22Br2O — CID 141293834
4-[1-[3-bromo-4-(2-bromoethyl)phenyl]-2-phenylbut-1-enyl]phenol (PubChem CID 141293834) has the molecular formula C24H22Br2O and a molecular weight of 486.25 g/mol. Its IUPAC name is 4-[1-[3-bromo-4-(2-bromoethyl)phenyl]-2-phenylbut-1-enyl]phenol.
| Compound Name | 4-[1-[3-bromo-4-(2-bromoethyl)phenyl]-2-phenylbut-1-enyl]phenol |
|---|---|
| PubChem CID | 141293834 |
| Molecular Formula | C24H22Br2O |
| Molecular Weight | 486.25 g/mol |
| Exact Mass | 484.00 |
| IUPAC Name | 4-[1-[3-bromo-4-(2-bromoethyl)phenyl]-2-phenylbut-1-enyl]phenol |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(CCBr)c(Br)c1)c1ccccc1 |
| InChI | InChI=1S/C24H22Br2O/c1-2-22(17-6-4-3-5-7-17)24(19-10-12-21(27)13-11-19)20-9-8-18(14-15-25)23(26)16-20/h3-13,16,27H,2,14-15H2,1H3 |
| InChIKey | WPNSKJKSZCDFOP-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.25 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|