C14H16N2O4 — CID 141299121
5-(butoxymethyl)-3-(4-nitrophenyl)-1,2-oxazole (PubChem CID 141299121) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 5-(butoxymethyl)-3-(4-nitrophenyl)-1,2-oxazole.
| Compound Name | 5-(butoxymethyl)-3-(4-nitrophenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 141299121 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 5-(butoxymethyl)-3-(4-nitrophenyl)-1,2-oxazole |
| SMILES | CCCCOCc1cc(-c2ccc([N+](=O)[O-])cc2)no1 |
| InChI | InChI=1S/C14H16N2O4/c1-2-3-8-19-10-13-9-14(15-20-13)11-4-6-12(7-5-11)16(17)18/h4-7,9H,2-3,8,10H2,1H3 |
| InChIKey | LYBUYACHINRCPI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 78.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|