C16H12N2O5 — CID 130348083
[3-(4-nitrophenyl)-1,2-oxazol-5-yl]methyl cyclopenta-2,4-diene-1-carboxylate (PubChem CID 130348083) has the molecular formula C16H12N2O5 and a molecular weight of 312.28 g/mol. Its IUPAC name is [3-(4-nitrophenyl)-1,2-oxazol-5-yl]methyl cyclopenta-2,4-diene-1-carboxylate.
| Compound Name | [3-(4-nitrophenyl)-1,2-oxazol-5-yl]methyl cyclopenta-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 130348083 |
| Molecular Formula | C16H12N2O5 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | [3-(4-nitrophenyl)-1,2-oxazol-5-yl]methyl cyclopenta-2,4-diene-1-carboxylate |
| SMILES | O=C(OCc1cc(-c2ccc([N+](=O)[O-])cc2)no1)C1C=CC=C1 |
| InChI | InChI=1S/C16H12N2O5/c19-16(12-3-1-2-4-12)22-10-14-9-15(17-23-14)11-5-7-13(8-6-11)18(20)21/h1-9,12H,10H2 |
| InChIKey | QLRBERGTUHGOAV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|