C16H16N6O4 — CID 126722711
6-ethyl-5-[[3-(4-nitrophenyl)-1,2-oxazol-5-yl]methoxy]pyrimidine-2,4-diamine (PubChem CID 126722711) has the molecular formula C16H16N6O4 and a molecular weight of 356.34 g/mol. Its IUPAC name is 6-ethyl-5-[[3-(4-nitrophenyl)-1,2-oxazol-5-yl]methoxy]pyrimidine-2,4-diamine.
| Compound Name | 6-ethyl-5-[[3-(4-nitrophenyl)-1,2-oxazol-5-yl]methoxy]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 126722711 |
| Molecular Formula | C16H16N6O4 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 6-ethyl-5-[[3-(4-nitrophenyl)-1,2-oxazol-5-yl]methoxy]pyrimidine-2,4-diamine |
| SMILES | CCc1nc(N)nc(N)c1OCc1cc(-c2ccc([N+](=O)[O-])cc2)no1 |
| InChI | InChI=1S/C16H16N6O4/c1-2-12-14(15(17)20-16(18)19-12)25-8-11-7-13(21-26-11)9-3-5-10(6-4-9)22(23)24/h3-7H,2,8H2,1H3,(H4,17,18,19,20) |
| InChIKey | WAVSYFXCLNEPSX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 156.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|