About (2-oxo-1-adamantyl) hydrogen carbonate
(2-oxo-1-adamantyl) hydrogen carbonate (PubChem CID 141301867) has the molecular formula C11H14O4
and a molecular weight of 210.23 g/mol. Its IUPAC name is (2-oxo-1-adamantyl) hydrogen carbonate.
Molecular Properties
| Compound Name | (2-oxo-1-adamantyl) hydrogen carbonate |
| PubChem CID | 141301867 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (2-oxo-1-adamantyl) hydrogen carbonate |
| SMILES | O=C(O)OC12CC3CC(CC(C3)C1=O)C2 |
| InChI | InChI=1S/C11H14O4/c12-9-8-2-6-1-7(3-8)5-11(9,4-6)15-10(13)14/h6-8H,1-5H2,(H,13,14) |
| InChIKey | VOVLXRQZVHLGLY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-oxo-1-adamantyl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-1-adamantyl) hydrogen carbonate?
The IUPAC name of (2-oxo-1-adamantyl) hydrogen carbonate (CID 141301867) is (2-oxo-1-adamantyl) hydrogen carbonate.
What is the SMILES notation for (2-oxo-1-adamantyl) hydrogen carbonate?
The canonical SMILES for (2-oxo-1-adamantyl) hydrogen carbonate is O=C(O)OC12CC3CC(CC(C3)C1=O)C2.
What is the InChIKey of (2-oxo-1-adamantyl) hydrogen carbonate?
The InChIKey is VOVLXRQZVHLGLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4/c12-9-8-2-6-1-7(3-8)5-11(9,4-6)15-10(13)14/h6-8H,1-5H2,(H,13,14).
What are the key properties of (2-oxo-1-adamantyl) hydrogen carbonate?
(2-oxo-1-adamantyl) hydrogen carbonate has a molecular weight of 210.23 g/mol, XLogP of 1.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-1-adamantyl) hydrogen carbonate is sourced from PubChem (CID 141301867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).