C12H17NO3 — CID 23375115
methyl N-[(5R,7R)-2-oxo-1-adamantyl]carbamate (PubChem CID 23375115) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is methyl N-[(5R,7R)-2-oxo-1-adamantyl]carbamate.
| Compound Name | methyl N-[(5R,7R)-2-oxo-1-adamantyl]carbamate |
|---|---|
| PubChem CID | 23375115 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | methyl N-[(5R,7R)-2-oxo-1-adamantyl]carbamate |
| SMILES | COC(=O)NC12C[C@H]3CC(C[C@@H](C3)C1)C2=O |
| InChI | InChI=1S/C12H17NO3/c1-16-11(15)13-12-5-7-2-8(6-12)4-9(3-7)10(12)14/h7-9H,2-6H2,1H3,(H,13,15)/t7-,8-,9?,12?/m1/s1 |
| InChIKey | ZGCWSWGOFPGKHH-JRSICPIFSA-N |
| XLogP | 1.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |