C29H28FNO3S — CID 141308110
(1R,2S)-3-fluoro-1-(4-methylsulfonylphenyl)-2-(tritylamino)propan-1-ol (PubChem CID 141308110) has the molecular formula C29H28FNO3S and a molecular weight of 489.61 g/mol. Its IUPAC name is (1R,2S)-3-fluoro-1-(4-methylsulfonylphenyl)-2-(tritylamino)propan-1-ol.
| Compound Name | (1R,2S)-3-fluoro-1-(4-methylsulfonylphenyl)-2-(tritylamino)propan-1-ol |
|---|---|
| PubChem CID | 141308110 |
| Molecular Formula | C29H28FNO3S |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | (1R,2S)-3-fluoro-1-(4-methylsulfonylphenyl)-2-(tritylamino)propan-1-ol |
| SMILES | CS(=O)(=O)c1ccc([C@@H](O)[C@@H](CF)NC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H28FNO3S/c1-35(33,34)26-19-17-22(18-20-26)28(32)27(21-30)31-29(23-11-5-2-6-12-23,24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-20,27-28,31-32H,21H2,1H3/t27-,28-/m1/s1 |
| InChIKey | MSDZODWZEMMYIF-VSGBNLITSA-N |
| XLogP | 5.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|