C23H26ClN3O — CID 141312296
N-(3-chlorophenyl)-7-hexoxy-4,5-dihydroimidazo[1,2-a]quinolin-1-amine (PubChem CID 141312296) has the molecular formula C23H26ClN3O and a molecular weight of 395.93 g/mol. Its IUPAC name is N-(3-chlorophenyl)-7-hexoxy-4,5-dihydroimidazo[1,2-a]quinolin-1-amine.
| Compound Name | N-(3-chlorophenyl)-7-hexoxy-4,5-dihydroimidazo[1,2-a]quinolin-1-amine |
|---|---|
| PubChem CID | 141312296 |
| Molecular Formula | C23H26ClN3O |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | N-(3-chlorophenyl)-7-hexoxy-4,5-dihydroimidazo[1,2-a]quinolin-1-amine |
| SMILES | CCCCCCOc1ccc2c(c1)CCc1ncc(Nc3cccc(Cl)c3)n1-2 |
| InChI | InChI=1S/C23H26ClN3O/c1-2-3-4-5-13-28-20-10-11-21-17(14-20)9-12-22-25-16-23(27(21)22)26-19-8-6-7-18(24)15-19/h6-8,10-11,14-16,26H,2-5,9,12-13H2,1H3 |
| InChIKey | JHIKYUZXURBAFT-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|