C15H8N2O — CID 141315799
8,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,7,9,11,13,15-octaen-6-one (PubChem CID 141315799) has the molecular formula C15H8N2O and a molecular weight of 232.24 g/mol. Its IUPAC name is 8,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,7,9,11,13,15-octaen-6-one.
| Compound Name | 8,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,7,9,11,13,15-octaen-6-one |
|---|---|
| PubChem CID | 141315799 |
| Molecular Formula | C15H8N2O |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 8,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,7,9,11,13,15-octaen-6-one |
| SMILES | O=C1C=CC=c2c1nc1cccc3nccc2c31 |
| InChI | InChI=1S/C15H8N2O/c18-13-6-1-3-10-9-7-8-16-11-4-2-5-12(14(9)11)17-15(10)13/h1-8H |
| InChIKey | AHXHZAOQSAANGA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |