C10H11NO5 — CID 141316230
4-anilino-2,2-dihydroxy-4-oxobutanoic acid (PubChem CID 141316230) has the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. Its IUPAC name is 4-anilino-2,2-dihydroxy-4-oxobutanoic acid.
| Compound Name | 4-anilino-2,2-dihydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 141316230 |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 4-anilino-2,2-dihydroxy-4-oxobutanoic acid |
| SMILES | O=C(CC(O)(O)C(=O)O)Nc1ccccc1 |
| InChI | InChI=1S/C10H11NO5/c12-8(6-10(15,16)9(13)14)11-7-4-2-1-3-5-7/h1-5,15-16H,6H2,(H,11,12)(H,13,14) |
| InChIKey | XUPDIYFFBMGPMH-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|