C14H19NO2 — CID 15681099
3-hydroxy-3,5-dimethyl-N-phenylhex-5-enamide (PubChem CID 15681099) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 3-hydroxy-3,5-dimethyl-N-phenylhex-5-enamide.
| Compound Name | 3-hydroxy-3,5-dimethyl-N-phenylhex-5-enamide |
|---|---|
| PubChem CID | 15681099 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 3-hydroxy-3,5-dimethyl-N-phenylhex-5-enamide |
| SMILES | C=C(C)CC(C)(O)CC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C14H19NO2/c1-11(2)9-14(3,17)10-13(16)15-12-7-5-4-6-8-12/h4-8,17H,1,9-10H2,2-3H3,(H,15,16) |
| InChIKey | BYJUQDVUPQSNJS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|