C5H11N3O3 — CID 141318868
1-N'-ethyl-1-N'-methoxy-2-nitroethene-1,1-diamine (PubChem CID 141318868) has the molecular formula C5H11N3O3 and a molecular weight of 161.16 g/mol. Its IUPAC name is 1-N'-ethyl-1-N'-methoxy-2-nitroethene-1,1-diamine.
| Compound Name | 1-N'-ethyl-1-N'-methoxy-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 141318868 |
| Molecular Formula | C5H11N3O3 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 1-N'-ethyl-1-N'-methoxy-2-nitroethene-1,1-diamine |
| SMILES | CCN(OC)C(N)=C[N+](=O)[O-] |
| InChI | InChI=1S/C5H11N3O3/c1-3-7(11-2)5(6)4-8(9)10/h4H,3,6H2,1-2H3 |
| InChIKey | VFZNFOCDWWPDJK-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|