About (4-dodecylphenyl)-dioxidoborane;ethylazanium
(4-dodecylphenyl)-dioxidoborane;ethylazanium (PubChem CID 141323740) has the molecular formula C22H45BN2O2
and a molecular weight of 380.43 g/mol. Its IUPAC name is (4-dodecylphenyl)-dioxidoborane;ethylazanium.
Molecular Properties
| Compound Name | (4-dodecylphenyl)-dioxidoborane;ethylazanium |
| PubChem CID | 141323740 |
| Molecular Formula | C22H45BN2O2 |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.36 |
| IUPAC Name | (4-dodecylphenyl)-dioxidoborane;ethylazanium |
| SMILES | CCCCCCCCCCCCc1ccc(B([O-])[O-])cc1.CC[NH3+].CC[NH3+] |
| InChI | InChI=1S/C18H29BO2.2C2H7N/c1-2-3-4-5-6-7-8-9-10-11-12-17-13-15-18(16-14-17)19(20)21;2*1-2-3/h13-16H,2-12H2,1H3;2*2-3H2,1H3/q-2;;/p+2 |
| InChIKey | UZYDJBRAVIQHKX-UHFFFAOYSA-P |
| XLogP | 1.06 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-dodecylphenyl)-dioxidoborane;ethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-dodecylphenyl)-dioxidoborane;ethylazanium?
The IUPAC name of (4-dodecylphenyl)-dioxidoborane;ethylazanium (CID 141323740) is (4-dodecylphenyl)-dioxidoborane;ethylazanium.
What is the SMILES notation for (4-dodecylphenyl)-dioxidoborane;ethylazanium?
The canonical SMILES for (4-dodecylphenyl)-dioxidoborane;ethylazanium is CCCCCCCCCCCCc1ccc(B([O-])[O-])cc1.CC[NH3+].CC[NH3+].
What is the InChIKey of (4-dodecylphenyl)-dioxidoborane;ethylazanium?
The InChIKey is UZYDJBRAVIQHKX-UHFFFAOYSA-P. The full InChI is InChI=1S/C18H29BO2.2C2H7N/c1-2-3-4-5-6-7-8-9-10-11-12-17-13-15-18(16-14-17)19(20)21;2*1-2-3/h13-16H,2-12H2,1H3;2*2-3H2,1H3/q-2;;/p+2.
What are the key properties of (4-dodecylphenyl)-dioxidoborane;ethylazanium?
(4-dodecylphenyl)-dioxidoborane;ethylazanium has a molecular weight of 380.43 g/mol, XLogP of 1.06, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-dodecylphenyl)-dioxidoborane;ethylazanium is sourced from PubChem (CID 141323740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).