3-(2-octylphenyl)pentan-3-yl hydrogen sulfite

C19H32O3S — CID 141324855

IUPAC3-(2-octylphenyl)pentan-3-yl hydrogen sulfite
SMILESCCCCCCCCc1ccccc1C(CC)(CC)OS(=O)O
InChIInChI=1S/C19H32O3S/c1-4-7-8-9-10-11-14-17-15-12-13-16-18(17)19(5-2,6-3)22-23(20)21/h12-13,15-16H,4-11,14H2,1-3H3,(H,20,21)
InChIKeyCKKZXLFNUWUQBH-UHFFFAOYSA-N
MW340.53 g/mol
LogP5.76
Rot. Bonds12

About 3-(2-octylphenyl)pentan-3-yl hydrogen sulfite

3-(2-octylphenyl)pentan-3-yl hydrogen sulfite (PubChem CID 141324855) has the molecular formula C19H32O3S and a molecular weight of 340.53 g/mol. Its IUPAC name is 3-(2-octylphenyl)pentan-3-yl hydrogen sulfite.

Molecular Properties

Compound Name3-(2-octylphenyl)pentan-3-yl hydrogen sulfite
PubChem CID141324855
Molecular FormulaC19H32O3S
Molecular Weight340.53 g/mol
Exact Mass340.21
IUPAC Name3-(2-octylphenyl)pentan-3-yl hydrogen sulfite
SMILESCCCCCCCCc1ccccc1C(CC)(CC)OS(=O)O
InChIInChI=1S/C19H32O3S/c1-4-7-8-9-10-11-14-17-15-12-13-16-18(17)19(5-2,6-3)22-23(20)21/h12-13,15-16H,4-11,14H2,1-3H3,(H,20,21)
InChIKeyCKKZXLFNUWUQBH-UHFFFAOYSA-N
XLogP5.76
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds12
Heavy Atoms23
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500340.53
LogP ≤ 55.76
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze 3-(2-octylphenyl)pentan-3-yl hydrogen sulfite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-octylphenyl)pentan-3-yl hydrogen sulfite?
The IUPAC name of 3-(2-octylphenyl)pentan-3-yl hydrogen sulfite (CID 141324855) is 3-(2-octylphenyl)pentan-3-yl hydrogen sulfite.
What is the SMILES notation for 3-(2-octylphenyl)pentan-3-yl hydrogen sulfite?
The canonical SMILES for 3-(2-octylphenyl)pentan-3-yl hydrogen sulfite is CCCCCCCCc1ccccc1C(CC)(CC)OS(=O)O.
What is the InChIKey of 3-(2-octylphenyl)pentan-3-yl hydrogen sulfite?
The InChIKey is CKKZXLFNUWUQBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32O3S/c1-4-7-8-9-10-11-14-17-15-12-13-16-18(17)19(5-2,6-3)22-23(20)21/h12-13,15-16H,4-11,14H2,1-3H3,(H,20,21).
What are the key properties of 3-(2-octylphenyl)pentan-3-yl hydrogen sulfite?
3-(2-octylphenyl)pentan-3-yl hydrogen sulfite has a molecular weight of 340.53 g/mol, XLogP of 5.76, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-octylphenyl)pentan-3-yl hydrogen sulfite is sourced from PubChem (CID 141324855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).