C16H8F6O3S — CID 141325858
2,6-bis(trifluoromethyl)anthracene-1-sulfonic acid (PubChem CID 141325858) has the molecular formula C16H8F6O3S and a molecular weight of 394.29 g/mol. Its IUPAC name is 2,6-bis(trifluoromethyl)anthracene-1-sulfonic acid.
| Compound Name | 2,6-bis(trifluoromethyl)anthracene-1-sulfonic acid |
|---|---|
| PubChem CID | 141325858 |
| Molecular Formula | C16H8F6O3S |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 2,6-bis(trifluoromethyl)anthracene-1-sulfonic acid |
| SMILES | O=S(=O)(O)c1c(C(F)(F)F)ccc2cc3cc(C(F)(F)F)ccc3cc12 |
| InChI | InChI=1S/C16H8F6O3S/c17-15(18,19)11-3-1-8-7-12-9(5-10(8)6-11)2-4-13(16(20,21)22)14(12)26(23,24)25/h1-7H,(H,23,24,25) |
| InChIKey | QIGPLQHLGCLLPQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|