About 2-[1-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]ethyl]-1,3-dioxolane
2-[1-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]ethyl]-1,3-dioxolane (PubChem CID 141329854) has the molecular formula C18H24F2O3
and a molecular weight of 326.38 g/mol. Its IUPAC name is 2-[1-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]ethyl]-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-[1-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]ethyl]-1,3-dioxolane |
| PubChem CID | 141329854 |
| Molecular Formula | C18H24F2O3 |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 2-[1-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]ethyl]-1,3-dioxolane |
| SMILES | COc1ccc(C2CCC(C(C)C3OCCO3)CC2)c(F)c1F |
| InChI | InChI=1S/C18H24F2O3/c1-11(18-22-9-10-23-18)12-3-5-13(6-4-12)14-7-8-15(21-2)17(20)16(14)19/h7-8,11-13,18H,3-6,9-10H2,1-2H3 |
| InChIKey | FJERKNQTCUSCHF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[1-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]ethyl]-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]ethyl]-1,3-dioxolane?
The IUPAC name of 2-[1-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]ethyl]-1,3-dioxolane (CID 141329854) is 2-[1-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]ethyl]-1,3-dioxolane.
What is the SMILES notation for 2-[1-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]ethyl]-1,3-dioxolane?
The canonical SMILES for 2-[1-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]ethyl]-1,3-dioxolane is COc1ccc(C2CCC(C(C)C3OCCO3)CC2)c(F)c1F.
What is the InChIKey of 2-[1-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]ethyl]-1,3-dioxolane?
The InChIKey is FJERKNQTCUSCHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24F2O3/c1-11(18-22-9-10-23-18)12-3-5-13(6-4-12)14-7-8-15(21-2)17(20)16(14)19/h7-8,11-13,18H,3-6,9-10H2,1-2H3.
What are the key properties of 2-[1-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]ethyl]-1,3-dioxolane?
2-[1-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]ethyl]-1,3-dioxolane has a molecular weight of 326.38 g/mol, XLogP of 4.26, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]ethyl]-1,3-dioxolane is sourced from PubChem (CID 141329854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).