C10H7N3OSe — CID 141330271
N-selenophen-3-ylfuro[3,2-d]pyrimidin-2-amine (PubChem CID 141330271) has the molecular formula C10H7N3OSe and a molecular weight of 264.15 g/mol. Its IUPAC name is N-selenophen-3-ylfuro[3,2-d]pyrimidin-2-amine.
| Compound Name | N-selenophen-3-ylfuro[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 141330271 |
| Molecular Formula | C10H7N3OSe |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 264.98 |
| IUPAC Name | N-selenophen-3-ylfuro[3,2-d]pyrimidin-2-amine |
| SMILES | c1cc2nc(Nc3cc[se]c3)ncc2o1 |
| InChI | InChI=1S/C10H7N3OSe/c1-3-14-9-5-11-10(13-8(1)9)12-7-2-4-15-6-7/h1-6H,(H,11,12,13) |
| InChIKey | KEKIUIQWVHFGQG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|