C11H13BrN2 — CID 141332929
(3S)-3-(4-bromophenyl)-3-methyl-1,2-dihydropyrrol-5-amine (PubChem CID 141332929) has the molecular formula C11H13BrN2 and a molecular weight of 253.14 g/mol. Its IUPAC name is (3S)-3-(4-bromophenyl)-3-methyl-1,2-dihydropyrrol-5-amine.
| Compound Name | (3S)-3-(4-bromophenyl)-3-methyl-1,2-dihydropyrrol-5-amine |
|---|---|
| PubChem CID | 141332929 |
| Molecular Formula | C11H13BrN2 |
| Molecular Weight | 253.14 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | (3S)-3-(4-bromophenyl)-3-methyl-1,2-dihydropyrrol-5-amine |
| SMILES | C[C@@]1(c2ccc(Br)cc2)C=C(N)NC1 |
| InChI | InChI=1S/C11H13BrN2/c1-11(6-10(13)14-7-11)8-2-4-9(12)5-3-8/h2-6,14H,7,13H2,1H3/t11-/m1/s1 |
| InChIKey | DOWIMEXKUJVHEF-LLVKDONJSA-N |
| XLogP | 2.11 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.14 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |