C8H4N4O — CID 141333234
pyrrolo[2,1-f]purin-2-one (PubChem CID 141333234) has the molecular formula C8H4N4O and a molecular weight of 172.15 g/mol. Its IUPAC name is pyrrolo[2,1-f]purin-2-one.
| Compound Name | pyrrolo[2,1-f]purin-2-one |
|---|---|
| PubChem CID | 141333234 |
| Molecular Formula | C8H4N4O |
| Molecular Weight | 172.15 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | pyrrolo[2,1-f]purin-2-one |
| SMILES | O=C1N=c2ncn3cccc3c2=N1 |
| InChI | InChI=1S/C8H4N4O/c13-8-10-6-5-2-1-3-12(5)4-9-7(6)11-8/h1-4H |
| InChIKey | MQUDNFPWKBOUAN-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 59.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.15 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |