C27H23N5O5S — CID 141333631
[7-[(2-cyanophenyl)methyl]-3-methyl-1-(naphthalen-1-ylmethyl)-2,6-dioxopurin-8-yl]methyl methanesulfonate (PubChem CID 141333631) has the molecular formula C27H23N5O5S and a molecular weight of 529.58 g/mol. Its IUPAC name is [7-[(2-cyanophenyl)methyl]-3-methyl-1-(naphthalen-1-ylmethyl)-2,6-dioxopurin-8-yl]methyl methanesulfonate.
| Compound Name | [7-[(2-cyanophenyl)methyl]-3-methyl-1-(naphthalen-1-ylmethyl)-2,6-dioxopurin-8-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 141333631 |
| Molecular Formula | C27H23N5O5S |
| Molecular Weight | 529.58 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | [7-[(2-cyanophenyl)methyl]-3-methyl-1-(naphthalen-1-ylmethyl)-2,6-dioxopurin-8-yl]methyl methanesulfonate |
| SMILES | Cn1c(=O)n(Cc2cccc3ccccc23)c(=O)c2c1nc(COS(C)(=O)=O)n2Cc1ccccc1C#N |
| InChI | InChI=1S/C27H23N5O5S/c1-30-25-24(26(33)32(27(30)34)16-21-12-7-11-18-8-5-6-13-22(18)21)31(23(29-25)17-37-38(2,35)36)15-20-10-4-3-9-19(20)14-28/h3-13H,15-17H2,1-2H3 |
| InChIKey | XJYKRUCGHUBWFF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 128.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.58 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|