C21H23N7O2 — CID 69055111
2-[[8-(2-aminopropylamino)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]benzonitrile (PubChem CID 69055111) has the molecular formula C21H23N7O2 and a molecular weight of 405.46 g/mol. Its IUPAC name is 2-[[8-(2-aminopropylamino)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]benzonitrile.
| Compound Name | 2-[[8-(2-aminopropylamino)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 69055111 |
| Molecular Formula | C21H23N7O2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 2-[[8-(2-aminopropylamino)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]benzonitrile |
| SMILES | CC#CCn1c(NCC(C)N)nc2c1c(=O)n(Cc1ccccc1C#N)c(=O)n2C |
| InChI | InChI=1S/C21H23N7O2/c1-4-5-10-27-17-18(25-20(27)24-12-14(2)23)26(3)21(30)28(19(17)29)13-16-9-7-6-8-15(16)11-22/h6-9,14H,10,12-13,23H2,1-3H3,(H,24,25) |
| InChIKey | JWVUDSMCTNWVAL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 123.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|