C11H9FO4 — CID 141334016
1,4-dihydroxybut-2-ynyl 2-fluorobenzoate (PubChem CID 141334016) has the molecular formula C11H9FO4 and a molecular weight of 224.19 g/mol. Its IUPAC name is 1,4-dihydroxybut-2-ynyl 2-fluorobenzoate.
| Compound Name | 1,4-dihydroxybut-2-ynyl 2-fluorobenzoate |
|---|---|
| PubChem CID | 141334016 |
| Molecular Formula | C11H9FO4 |
| Molecular Weight | 224.19 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 1,4-dihydroxybut-2-ynyl 2-fluorobenzoate |
| SMILES | O=C(OC(O)C#CCO)c1ccccc1F |
| InChI | InChI=1S/C11H9FO4/c12-9-5-2-1-4-8(9)11(15)16-10(14)6-3-7-13/h1-2,4-5,10,13-14H,7H2 |
| InChIKey | MQDMKJMBRAIBDT-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.19 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|