C29H31NO3 — CID 141336056
phenyl 2-[[(3R,4R)-4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]methyl]-3-phenylprop-2-enoate (PubChem CID 141336056) has the molecular formula C29H31NO3 and a molecular weight of 441.57 g/mol. Its IUPAC name is phenyl 2-[[(3R,4R)-4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]methyl]-3-phenylprop-2-enoate.
| Compound Name | phenyl 2-[[(3R,4R)-4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]methyl]-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 141336056 |
| Molecular Formula | C29H31NO3 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | phenyl 2-[[(3R,4R)-4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]methyl]-3-phenylprop-2-enoate |
| SMILES | C[C@H]1CN(CC(=Cc2ccccc2)C(=O)Oc2ccccc2)CC[C@@]1(C)c1cccc(O)c1 |
| InChI | InChI=1S/C29H31NO3/c1-22-20-30(17-16-29(22,2)25-12-9-13-26(31)19-25)21-24(18-23-10-5-3-6-11-23)28(32)33-27-14-7-4-8-15-27/h3-15,18-19,22,31H,16-17,20-21H2,1-2H3/t22-,29+/m0/s1 |
| InChIKey | VLKUNUNZHYFUFS-PZGXJGMVSA-N |
| XLogP | 5.68 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|