C21H27N3O — CID 141337083
N-(6-aminohexyl)-4-(1,3-dihydroisoindol-2-yl)benzamide (PubChem CID 141337083) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is N-(6-aminohexyl)-4-(1,3-dihydroisoindol-2-yl)benzamide.
| Compound Name | N-(6-aminohexyl)-4-(1,3-dihydroisoindol-2-yl)benzamide |
|---|---|
| PubChem CID | 141337083 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | N-(6-aminohexyl)-4-(1,3-dihydroisoindol-2-yl)benzamide |
| SMILES | NCCCCCCNC(=O)c1ccc(N2Cc3ccccc3C2)cc1 |
| InChI | InChI=1S/C21H27N3O/c22-13-5-1-2-6-14-23-21(25)17-9-11-20(12-10-17)24-15-18-7-3-4-8-19(18)16-24/h3-4,7-12H,1-2,5-6,13-16,22H2,(H,23,25) |
| InChIKey | WJPGADSQJSGYJC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|