C19H12Br2F2O — CID 141338587
1,3-dibromo-2,4-difluoro-7,7-dimethylbenzo[c]fluoren-5-ol (PubChem CID 141338587) has the molecular formula C19H12Br2F2O and a molecular weight of 454.11 g/mol. Its IUPAC name is 1,3-dibromo-2,4-difluoro-7,7-dimethylbenzo[c]fluoren-5-ol.
| Compound Name | 1,3-dibromo-2,4-difluoro-7,7-dimethylbenzo[c]fluoren-5-ol |
|---|---|
| PubChem CID | 141338587 |
| Molecular Formula | C19H12Br2F2O |
| Molecular Weight | 454.11 g/mol |
| Exact Mass | 451.92 |
| IUPAC Name | 1,3-dibromo-2,4-difluoro-7,7-dimethylbenzo[c]fluoren-5-ol |
| SMILES | CC1(C)c2ccccc2-c2c1cc(O)c1c(F)c(Br)c(F)c(Br)c21 |
| InChI | InChI=1S/C19H12Br2F2O/c1-19(2)9-6-4-3-5-8(9)12-10(19)7-11(24)13-14(12)15(20)18(23)16(21)17(13)22/h3-7,24H,1-2H3 |
| InChIKey | RKISOPFQHFQGEQ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.11 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|