C25H30N2O — CID 20689891
7,7-bis(dimethylamino)-1,2,3,4-tetramethylbenzo[c]fluoren-5-ol (PubChem CID 20689891) has the molecular formula C25H30N2O and a molecular weight of 374.53 g/mol. Its IUPAC name is 7,7-bis(dimethylamino)-1,2,3,4-tetramethylbenzo[c]fluoren-5-ol.
| Compound Name | 7,7-bis(dimethylamino)-1,2,3,4-tetramethylbenzo[c]fluoren-5-ol |
|---|---|
| PubChem CID | 20689891 |
| Molecular Formula | C25H30N2O |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 7,7-bis(dimethylamino)-1,2,3,4-tetramethylbenzo[c]fluoren-5-ol |
| SMILES | Cc1c(C)c(C)c2c3c(cc(O)c2c1C)C(N(C)C)(N(C)C)c1ccccc1-3 |
| InChI | InChI=1S/C25H30N2O/c1-14-15(2)17(4)23-22(16(14)3)21(28)13-20-24(23)18-11-9-10-12-19(18)25(20,26(5)6)27(7)8/h9-13,28H,1-8H3 |
| InChIKey | ZSMZFVDOEPHJCL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|