C16H26O2 — CID 141339516
2,3-dimethyl-6-octoxycyclohexa-2,4-dien-1-one (PubChem CID 141339516) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 2,3-dimethyl-6-octoxycyclohexa-2,4-dien-1-one.
| Compound Name | 2,3-dimethyl-6-octoxycyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 141339516 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 2,3-dimethyl-6-octoxycyclohexa-2,4-dien-1-one |
| SMILES | CCCCCCCCOC1C=CC(C)=C(C)C1=O |
| InChI | InChI=1S/C16H26O2/c1-4-5-6-7-8-9-12-18-15-11-10-13(2)14(3)16(15)17/h10-11,15H,4-9,12H2,1-3H3 |
| InChIKey | IRRUABJLFNPUIS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|