About 3-pentoxy-3H-furan-2-one
3-pentoxy-3H-furan-2-one (PubChem CID 70212085) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is 3-pentoxy-3H-furan-2-one.
Molecular Properties
| Compound Name | 3-pentoxy-3H-furan-2-one |
| PubChem CID | 70212085 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 3-pentoxy-3H-furan-2-one |
| SMILES | CCCCCOC1C=COC1=O |
| InChI | InChI=1S/C9H14O3/c1-2-3-4-6-11-8-5-7-12-9(8)10/h5,7-8H,2-4,6H2,1H3 |
| InChIKey | PSYMIBODNPJHHB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-pentoxy-3H-furan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pentoxy-3H-furan-2-one?
The IUPAC name of 3-pentoxy-3H-furan-2-one (CID 70212085) is 3-pentoxy-3H-furan-2-one.
What is the SMILES notation for 3-pentoxy-3H-furan-2-one?
The canonical SMILES for 3-pentoxy-3H-furan-2-one is CCCCCOC1C=COC1=O.
What is the InChIKey of 3-pentoxy-3H-furan-2-one?
The InChIKey is PSYMIBODNPJHHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-2-3-4-6-11-8-5-7-12-9(8)10/h5,7-8H,2-4,6H2,1H3.
What are the key properties of 3-pentoxy-3H-furan-2-one?
3-pentoxy-3H-furan-2-one has a molecular weight of 170.21 g/mol, XLogP of 1.63, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentoxy-3H-furan-2-one is sourced from PubChem (CID 70212085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).