C10H11NO — CID 141339996
2,7-dihydro-1H-cyclohepta[b]pyridin-9-ol (PubChem CID 141339996) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is 2,7-dihydro-1H-cyclohepta[b]pyridin-9-ol.
| Compound Name | 2,7-dihydro-1H-cyclohepta[b]pyridin-9-ol |
|---|---|
| PubChem CID | 141339996 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 2,7-dihydro-1H-cyclohepta[b]pyridin-9-ol |
| SMILES | OC1=CCC=CC2=C1NCC=C2 |
| InChI | InChI=1S/C10H11NO/c12-9-6-2-1-4-8-5-3-7-11-10(8)9/h1,3-6,11-12H,2,7H2 |
| InChIKey | SHCNVXBGRZMOGG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |