C19H31NO — CID 144851096
ethane;(2E,4E,6Z)-4-[[(2E,4Z)-2-ethenyl-3-methylhexa-2,4-dienyl]amino]octa-2,4,6-trien-3-ol (PubChem CID 144851096) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is ethane;(2E,4E,6Z)-4-[[(2E,4Z)-2-ethenyl-3-methylhexa-2,4-dienyl]amino]octa-2,4,6-trien-3-ol.
| Compound Name | ethane;(2E,4E,6Z)-4-[[(2E,4Z)-2-ethenyl-3-methylhexa-2,4-dienyl]amino]octa-2,4,6-trien-3-ol |
|---|---|
| PubChem CID | 144851096 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | ethane;(2E,4E,6Z)-4-[[(2E,4Z)-2-ethenyl-3-methylhexa-2,4-dienyl]amino]octa-2,4,6-trien-3-ol |
| SMILES | C=C/C(CNC(=C/C=C\C)/C(O)=C\C)=C(C)\C=C/C.CC |
| InChI | InChI=1S/C17H25NO.C2H6/c1-6-10-12-16(17(19)9-4)18-13-15(8-3)14(5)11-7-2;1-2/h6-12,18-19H,3,13H2,1-2,4-5H3;1-2H3/b10-6-,11-7-,15-14+,16-12+,17-9+; |
| InChIKey | XZDSGESQZFRDLF-VNVHVODMSA-N |
| XLogP | 5.60 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|