C9H17NO — CID 166783149
(3E)-2-(propylamino)hexa-1,3-dien-3-ol (PubChem CID 166783149) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is (3E)-2-(propylamino)hexa-1,3-dien-3-ol.
| Compound Name | (3E)-2-(propylamino)hexa-1,3-dien-3-ol |
|---|---|
| PubChem CID | 166783149 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | (3E)-2-(propylamino)hexa-1,3-dien-3-ol |
| SMILES | C=C(NCCC)/C(O)=C\CC |
| InChI | InChI=1S/C9H17NO/c1-4-6-9(11)8(3)10-7-5-2/h6,10-11H,3-5,7H2,1-2H3/b9-6+ |
| InChIKey | MVHGHFZNNZVEAZ-RMKNXTFCSA-N |
| XLogP | 2.35 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|