C17H30N2O — CID 143279607
(3E,5E)-2-(dipropylamino)-5-[1-(ethylamino)ethenyl]hepta-1,3,5-trien-3-ol (PubChem CID 143279607) has the molecular formula C17H30N2O and a molecular weight of 278.44 g/mol. Its IUPAC name is (3E,5E)-2-(dipropylamino)-5-[1-(ethylamino)ethenyl]hepta-1,3,5-trien-3-ol.
| Compound Name | (3E,5E)-2-(dipropylamino)-5-[1-(ethylamino)ethenyl]hepta-1,3,5-trien-3-ol |
|---|---|
| PubChem CID | 143279607 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | (3E,5E)-2-(dipropylamino)-5-[1-(ethylamino)ethenyl]hepta-1,3,5-trien-3-ol |
| SMILES | C=C(NCC)C(/C=C(/O)C(=C)N(CCC)CCC)=C/C |
| InChI | InChI=1S/C17H30N2O/c1-7-11-19(12-8-2)15(6)17(20)13-16(9-3)14(5)18-10-4/h9,13,18,20H,5-8,10-12H2,1-4H3/b16-9+,17-13+ |
| InChIKey | MIPHHYSVHOVSKW-LRUHSSMMSA-N |
| XLogP | 4.13 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|